C23H22N4O3 — CID 22626541
2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-(methylaminomethyl)phenyl]benzoic acid (PubChem CID 22626541) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-(methylaminomethyl)phenyl]benzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-(methylaminomethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 22626541 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-(methylaminomethyl)phenyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(CNC)ccc2-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C23H22N4O3/c1-26-13-14-6-11-18(17-4-2-3-5-19(17)23(29)30)20(12-14)22(28)27-16-9-7-15(8-10-16)21(24)25/h2-12,26H,13H2,1H3,(H3,24,25)(H,27,28)(H,29,30) |
| InChIKey | GBWRWWXUQONVDH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 128.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|