C23H19N3O5 — CID 139928723
2-[4-acetyloxy-2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoic acid (PubChem CID 139928723) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is 2-[4-acetyloxy-2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoic acid.
| Compound Name | 2-[4-acetyloxy-2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 139928723 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[4-acetyloxy-2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(OC(C)=O)ccc2-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C23H19N3O5/c1-13(27)31-16-10-11-18(17-4-2-3-5-19(17)23(29)30)20(12-16)22(28)26-15-8-6-14(7-9-15)21(24)25/h2-12H,1H3,(H3,24,25)(H,26,28)(H,29,30) |
| InChIKey | KNLINOOWGKHNNN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|