C24H20F3N3O5 — CID 22626223
methoxymethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-(trifluoromethoxy)phenyl]benzoate (PubChem CID 22626223) has the molecular formula C24H20F3N3O5 and a molecular weight of 487.43 g/mol. Its IUPAC name is methoxymethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-(trifluoromethoxy)phenyl]benzoate.
| Compound Name | methoxymethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-(trifluoromethoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 22626223 |
| Molecular Formula | C24H20F3N3O5 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | methoxymethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-(trifluoromethoxy)phenyl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(OC(F)(F)F)ccc2-c2ccccc2C(=O)OCOC)cc1 |
| InChI | InChI=1S/C24H20F3N3O5/c1-33-13-34-23(32)19-5-3-2-4-17(19)18-11-10-16(35-24(25,26)27)12-20(18)22(31)30-15-8-6-14(7-9-15)21(28)29/h2-12H,13H2,1H3,(H3,28,29)(H,30,31) |
| InChIKey | RNFOECOSJTZXGV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|