C28H30N4O4 — CID 18685481
ethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate (PubChem CID 18685481) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is ethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate.
| Compound Name | ethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 18685481 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | ethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccccc2-c2ccc(C(=O)NCC(C)C)cc2C(=O)OCC)cc1 |
| InChI | InChI=1S/C28H30N4O4/c1-4-36-28(35)24-15-19(26(33)31-16-17(2)3)11-14-22(24)21-7-5-6-8-23(21)27(34)32-20-12-9-18(10-13-20)25(29)30/h5-15,17H,4,16H2,1-3H3,(H3,29,30)(H,31,33)(H,32,34) |
| InChIKey | YMZMUGHOCKLIFE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|