C31H36N4O5 — CID 59879907
ethyl 2-[2-[[4-(N'-ethoxycarbonylcarbamimidoyl)anilino]methyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate (PubChem CID 59879907) has the molecular formula C31H36N4O5 and a molecular weight of 544.65 g/mol. Its IUPAC name is ethyl 2-[2-[[4-(N'-ethoxycarbonylcarbamimidoyl)anilino]methyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate.
| Compound Name | ethyl 2-[2-[[4-(N'-ethoxycarbonylcarbamimidoyl)anilino]methyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 59879907 |
| Molecular Formula | C31H36N4O5 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | ethyl 2-[2-[[4-(N'-ethoxycarbonylcarbamimidoyl)anilino]methyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate |
| SMILES | CCOC(=O)N=C(N)c1ccc(NCc2ccccc2-c2ccc(C(=O)NCC(C)C)cc2C(=O)OCC)cc1 |
| InChI | InChI=1S/C31H36N4O5/c1-5-39-30(37)27-17-22(29(36)34-18-20(3)4)13-16-26(27)25-10-8-7-9-23(25)19-33-24-14-11-21(12-15-24)28(32)35-31(38)40-6-2/h7-17,20,33H,5-6,18-19H2,1-4H3,(H,34,36)(H2,32,35,38) |
| InChIKey | BFLFSKXLJPEKIC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|