C29H35N4O6S- — CID 22626081
ethyl 2-[2-[(4-carbamimidoylanilino)methyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate;methanesulfonate (PubChem CID 22626081) has the molecular formula C29H35N4O6S- and a molecular weight of 567.69 g/mol. Its IUPAC name is ethyl 2-[2-[(4-carbamimidoylanilino)methyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate;methanesulfonate.
| Compound Name | ethyl 2-[2-[(4-carbamimidoylanilino)methyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate;methanesulfonate |
|---|---|
| PubChem CID | 22626081 |
| Molecular Formula | C29H35N4O6S- |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | ethyl 2-[2-[(4-carbamimidoylanilino)methyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].[H]/N=C(\N)c1ccc(NCc2ccccc2-c2ccc(C(=O)NCC(C)C)cc2C(=O)OCC)cc1 |
| InChI | InChI=1S/C28H32N4O3.CH4O3S/c1-4-35-28(34)25-15-20(27(33)32-16-18(2)3)11-14-24(25)23-8-6-5-7-21(23)17-31-22-12-9-19(10-13-22)26(29)30;1-5(2,3)4/h5-15,18,31H,4,16-17H2,1-3H3,(H3,29,30)(H,32,33);1H3,(H,2,3,4)/p-1 |
| InChIKey | DMEQWOQMCLGYIK-UHFFFAOYSA-M |
| XLogP | 3.97 |
| TPSA | 174.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|