C33H32N4O5 — CID 20631503
2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-phenylmethoxyphenyl]-5-(2-methylpropylcarbamoyl)benzoic acid (PubChem CID 20631503) has the molecular formula C33H32N4O5 and a molecular weight of 564.64 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-phenylmethoxyphenyl]-5-(2-methylpropylcarbamoyl)benzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-phenylmethoxyphenyl]-5-(2-methylpropylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 20631503 |
| Molecular Formula | C33H32N4O5 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-phenylmethoxyphenyl]-5-(2-methylpropylcarbamoyl)benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(OCc3ccccc3)ccc2-c2ccc(C(=O)NCC(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C33H32N4O5/c1-20(2)18-36-31(38)23-10-14-27(29(16-23)33(40)41)26-15-13-25(42-19-21-6-4-3-5-7-21)17-28(26)32(39)37-24-11-8-22(9-12-24)30(34)35/h3-17,20H,18-19H2,1-2H3,(H3,34,35)(H,36,38)(H,37,39)(H,40,41) |
| InChIKey | PVNKAXPFPSJGHG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 154.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|