C31H30N4O5S — CID 22336172
2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-[2-(hydroxymethyl)thiophen-3-yl]phenyl]-5-(2-methylpropylcarbamoyl)benzoic acid (PubChem CID 22336172) has the molecular formula C31H30N4O5S and a molecular weight of 570.67 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-[2-(hydroxymethyl)thiophen-3-yl]phenyl]-5-(2-methylpropylcarbamoyl)benzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-[2-(hydroxymethyl)thiophen-3-yl]phenyl]-5-(2-methylpropylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 22336172 |
| Molecular Formula | C31H30N4O5S |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-[2-(hydroxymethyl)thiophen-3-yl]phenyl]-5-(2-methylpropylcarbamoyl)benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(-c3ccsc3CO)ccc2-c2ccc(C(=O)NCC(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H30N4O5S/c1-17(2)15-34-29(37)20-6-10-24(26(14-20)31(39)40)23-9-5-19(22-11-12-41-27(22)16-36)13-25(23)30(38)35-21-7-3-18(4-8-21)28(32)33/h3-14,17,36H,15-16H2,1-2H3,(H3,32,33)(H,34,37)(H,35,38)(H,39,40) |
| InChIKey | REKBLSLNDZXMEV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 165.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|