C33H35N5O4S — CID 142138526
methyl 2-[4-[4-(aminomethyl)thiophen-3-yl]-2-[[4-(N'-methylcarbamimidoyl)phenyl]carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate (PubChem CID 142138526) has the molecular formula C33H35N5O4S and a molecular weight of 597.74 g/mol. Its IUPAC name is methyl 2-[4-[4-(aminomethyl)thiophen-3-yl]-2-[[4-(N'-methylcarbamimidoyl)phenyl]carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate.
| Compound Name | methyl 2-[4-[4-(aminomethyl)thiophen-3-yl]-2-[[4-(N'-methylcarbamimidoyl)phenyl]carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 142138526 |
| Molecular Formula | C33H35N5O4S |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | methyl 2-[4-[4-(aminomethyl)thiophen-3-yl]-2-[[4-(N'-methylcarbamimidoyl)phenyl]carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate |
| SMILES | C/N=C(\N)c1ccc(NC(=O)c2cc(-c3cscc3CN)ccc2-c2ccc(C(=O)NCC(C)C)cc2C(=O)OC)cc1 |
| InChI | InChI=1S/C33H35N5O4S/c1-19(2)16-37-31(39)22-8-12-26(28(14-22)33(41)42-4)25-11-7-21(29-18-43-17-23(29)15-34)13-27(25)32(40)38-24-9-5-20(6-10-24)30(35)36-3/h5-14,17-19H,15-16,34H2,1-4H3,(H2,35,36)(H,37,39)(H,38,40) |
| InChIKey | FEZKUBWSZOFPOD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|