C33H32N4O4 — CID 22626171
benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate (PubChem CID 22626171) has the molecular formula C33H32N4O4 and a molecular weight of 548.64 g/mol. Its IUPAC name is benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate.
| Compound Name | benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 22626171 |
| Molecular Formula | C33H32N4O4 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccccc2-c2ccc(C(=O)NCC(C)C)cc2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H32N4O4/c1-21(2)19-36-31(38)24-14-17-27(29(18-24)33(40)41-20-22-8-4-3-5-9-22)26-10-6-7-11-28(26)32(39)37-25-15-12-23(13-16-25)30(34)35/h3-18,21H,19-20H2,1-2H3,(H3,34,35)(H,36,38)(H,37,39) |
| InChIKey | UTAPTXYZUQZYKS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|