C32H29N3O6 — CID 22626536
benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2-ethoxy-2-oxoethoxy)benzoate (PubChem CID 22626536) has the molecular formula C32H29N3O6 and a molecular weight of 551.60 g/mol. Its IUPAC name is benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2-ethoxy-2-oxoethoxy)benzoate.
| Compound Name | benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2-ethoxy-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 22626536 |
| Molecular Formula | C32H29N3O6 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2-ethoxy-2-oxoethoxy)benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccccc2-c2ccc(OCC(=O)OCC)cc2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H29N3O6/c1-2-39-29(36)20-40-24-16-17-26(28(18-24)32(38)41-19-21-8-4-3-5-9-21)25-10-6-7-11-27(25)31(37)35-23-14-12-22(13-15-23)30(33)34/h3-18H,2,19-20H2,1H3,(H3,33,34)(H,35,37) |
| InChIKey | PRACHZNRWYOZDV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 140.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|