C35H31N3O5 — CID 22626001
benzyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-8-(2-methoxyethoxy)naphthalene-2-carboxylate (PubChem CID 22626001) has the molecular formula C35H31N3O5 and a molecular weight of 573.65 g/mol. Its IUPAC name is benzyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-8-(2-methoxyethoxy)naphthalene-2-carboxylate.
| Compound Name | benzyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-8-(2-methoxyethoxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 22626001 |
| Molecular Formula | C35H31N3O5 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | benzyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-8-(2-methoxyethoxy)naphthalene-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccccc2-c2cc3cccc(OCCOC)c3cc2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H31N3O5/c1-41-18-19-42-32-13-7-10-25-20-30(31(21-29(25)32)35(40)43-22-23-8-3-2-4-9-23)27-11-5-6-12-28(27)34(39)38-26-16-14-24(15-17-26)33(36)37/h2-17,20-21H,18-19,22H2,1H3,(H3,36,37)(H,38,39) |
| InChIKey | XFBGJOOBHSVLKE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|