C33H33N5O5 — CID 18685330
benzyl 2-[4-[(4-carbamimidoylphenyl)carbamoyl]-3-pyridinyl]-5-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]benzoate (PubChem CID 18685330) has the molecular formula C33H33N5O5 and a molecular weight of 579.66 g/mol. Its IUPAC name is benzyl 2-[4-[(4-carbamimidoylphenyl)carbamoyl]-3-pyridinyl]-5-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]benzoate.
| Compound Name | benzyl 2-[4-[(4-carbamimidoylphenyl)carbamoyl]-3-pyridinyl]-5-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 18685330 |
| Molecular Formula | C33H33N5O5 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | benzyl 2-[4-[(4-carbamimidoylphenyl)carbamoyl]-3-pyridinyl]-5-[[(2S)-1-hydroxy-3-methylbutan-2-yl]carbamoyl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccncc2-c2ccc(C(=O)N[C@H](CO)C(C)C)cc2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H33N5O5/c1-20(2)29(18-39)38-31(40)23-10-13-25(27(16-23)33(42)43-19-21-6-4-3-5-7-21)28-17-36-15-14-26(28)32(41)37-24-11-8-22(9-12-24)30(34)35/h3-17,20,29,39H,18-19H2,1-2H3,(H3,34,35)(H,37,41)(H,38,40)/t29-/m1/s1 |
| InChIKey | ZJQUJHAXLWKDGV-GDLZYMKVSA-N |
| XLogP | 4.39 |
| TPSA | 167.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|