C40H37N5O6 — CID 59879887
benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-3-pyridinyl]-5-[[(2S)-3-methyl-1-oxo-1-phenylmethoxybutan-2-yl]carbamoyl]benzoate (PubChem CID 59879887) has the molecular formula C40H37N5O6 and a molecular weight of 683.77 g/mol. Its IUPAC name is benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-3-pyridinyl]-5-[[(2S)-3-methyl-1-oxo-1-phenylmethoxybutan-2-yl]carbamoyl]benzoate.
| Compound Name | benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-3-pyridinyl]-5-[[(2S)-3-methyl-1-oxo-1-phenylmethoxybutan-2-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 59879887 |
| Molecular Formula | C40H37N5O6 |
| Molecular Weight | 683.77 g/mol |
| Exact Mass | 683.27 |
| IUPAC Name | benzyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-3-pyridinyl]-5-[[(2S)-3-methyl-1-oxo-1-phenylmethoxybutan-2-yl]carbamoyl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ncccc2-c2ccc(C(=O)N[C@H](C(=O)OCc3ccccc3)C(C)C)cc2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C40H37N5O6/c1-25(2)34(40(49)51-24-27-12-7-4-8-13-27)45-37(46)29-17-20-31(33(22-29)39(48)50-23-26-10-5-3-6-11-26)32-14-9-21-43-35(32)38(47)44-30-18-15-28(16-19-30)36(41)42/h3-22,25,34H,23-24H2,1-2H3,(H3,41,42)(H,44,47)(H,45,46)/t34-/m0/s1 |
| InChIKey | SJAXVIKOVICJAG-UMSFTDKQSA-N |
| XLogP | 6.14 |
| TPSA | 173.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.77 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|