C36H40N6O5 — CID 59879924
benzyl 5-[[(3R)-1-amino-4,4-dimethylpentan-3-yl]carbamoyl]-2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]benzoate (PubChem CID 59879924) has the molecular formula C36H40N6O5 and a molecular weight of 636.75 g/mol. Its IUPAC name is benzyl 5-[[(3R)-1-amino-4,4-dimethylpentan-3-yl]carbamoyl]-2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]benzoate.
| Compound Name | benzyl 5-[[(3R)-1-amino-4,4-dimethylpentan-3-yl]carbamoyl]-2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]benzoate |
|---|---|
| PubChem CID | 59879924 |
| Molecular Formula | C36H40N6O5 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | benzyl 5-[[(3R)-1-amino-4,4-dimethylpentan-3-yl]carbamoyl]-2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxy-3-pyridinyl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2nc(OC)ccc2-c2ccc(C(=O)N[C@H](CCN)C(C)(C)C)cc2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H40N6O5/c1-36(2,3)29(18-19-37)41-33(43)24-12-15-26(28(20-24)35(45)47-21-22-8-6-5-7-9-22)27-16-17-30(46-4)42-31(27)34(44)40-25-13-10-23(11-14-25)32(38)39/h5-17,20,29H,18-19,21,37H2,1-4H3,(H3,38,39)(H,40,44)(H,41,43)/t29-/m1/s1 |
| InChIKey | UCELHOFYCIZSGN-GDLZYMKVSA-N |
| XLogP | 5.14 |
| TPSA | 182.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|