C30H36N6O5 — CID 22625994
5-[(1-amino-4-methylhexan-3-yl)carbamoyl]-2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]benzoic acid (PubChem CID 22625994) has the molecular formula C30H36N6O5 and a molecular weight of 560.66 g/mol. Its IUPAC name is 5-[(1-amino-4-methylhexan-3-yl)carbamoyl]-2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]benzoic acid.
| Compound Name | 5-[(1-amino-4-methylhexan-3-yl)carbamoyl]-2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 22625994 |
| Molecular Formula | C30H36N6O5 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 5-[(1-amino-4-methylhexan-3-yl)carbamoyl]-2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2nc(OCC)ccc2-c2ccc(C(=O)NC(CCN)C(C)CC)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C30H36N6O5/c1-4-17(3)24(14-15-31)35-28(37)19-8-11-21(23(16-19)30(39)40)22-12-13-25(41-5-2)36-26(22)29(38)34-20-9-6-18(7-10-20)27(32)33/h6-13,16-17,24H,4-5,14-15,31H2,1-3H3,(H3,32,33)(H,34,38)(H,35,37)(H,39,40) |
| InChIKey | NXOJLOLQJIEFON-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 193.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|