C38H42N6O7 — CID 139928715
2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]-5-[[(3S,4S)-4-methyl-1-(phenylmethoxycarbonylamino)hexan-3-yl]carbamoyl]benzoic acid (PubChem CID 139928715) has the molecular formula C38H42N6O7 and a molecular weight of 694.79 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]-5-[[(3S,4S)-4-methyl-1-(phenylmethoxycarbonylamino)hexan-3-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]-5-[[(3S,4S)-4-methyl-1-(phenylmethoxycarbonylamino)hexan-3-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 139928715 |
| Molecular Formula | C38H42N6O7 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.31 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]-5-[[(3S,4S)-4-methyl-1-(phenylmethoxycarbonylamino)hexan-3-yl]carbamoyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2nc(OCC)ccc2-c2ccc(C(=O)N[C@@H](CCNC(=O)OCc3ccccc3)[C@@H](C)CC)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C38H42N6O7/c1-4-23(3)31(19-20-41-38(49)51-22-24-9-7-6-8-10-24)43-35(45)26-13-16-28(30(21-26)37(47)48)29-17-18-32(50-5-2)44-33(29)36(46)42-27-14-11-25(12-15-27)34(39)40/h6-18,21,23,31H,4-5,19-20,22H2,1-3H3,(H3,39,40)(H,41,49)(H,42,46)(H,43,45)(H,47,48)/t23-,31-/m0/s1 |
| InChIKey | YJNIYRHSFLYPSZ-FWUCURJTSA-N |
| XLogP | 5.84 |
| TPSA | 205.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|