C37H40N6O7 — CID 139928713
2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]-5-[[(3S)-4-methyl-1-(phenylmethoxycarbonylamino)pentan-3-yl]carbamoyl]benzoic acid (PubChem CID 139928713) has the molecular formula C37H40N6O7 and a molecular weight of 680.76 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]-5-[[(3S)-4-methyl-1-(phenylmethoxycarbonylamino)pentan-3-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]-5-[[(3S)-4-methyl-1-(phenylmethoxycarbonylamino)pentan-3-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 139928713 |
| Molecular Formula | C37H40N6O7 |
| Molecular Weight | 680.76 g/mol |
| Exact Mass | 680.30 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]-5-[[(3S)-4-methyl-1-(phenylmethoxycarbonylamino)pentan-3-yl]carbamoyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2nc(OCC)ccc2-c2ccc(C(=O)N[C@@H](CCNC(=O)OCc3ccccc3)C(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C37H40N6O7/c1-4-49-31-17-16-28(32(43-31)35(45)41-26-13-10-24(11-14-26)33(38)39)27-15-12-25(20-29(27)36(46)47)34(44)42-30(22(2)3)18-19-40-37(48)50-21-23-8-6-5-7-9-23/h5-17,20,22,30H,4,18-19,21H2,1-3H3,(H3,38,39)(H,40,48)(H,41,45)(H,42,44)(H,46,47)/t30-/m0/s1 |
| InChIKey | PGLADAFLPKJRMO-PMERELPUSA-N |
| XLogP | 5.45 |
| TPSA | 205.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.76 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|