C29H34N6O5 — CID 22626021
5-[(1-amino-4-methylpentan-3-yl)carbamoyl]-2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]benzoic acid (PubChem CID 22626021) has the molecular formula C29H34N6O5 and a molecular weight of 546.63 g/mol. Its IUPAC name is 5-[(1-amino-4-methylpentan-3-yl)carbamoyl]-2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]benzoic acid.
| Compound Name | 5-[(1-amino-4-methylpentan-3-yl)carbamoyl]-2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 22626021 |
| Molecular Formula | C29H34N6O5 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 5-[(1-amino-4-methylpentan-3-yl)carbamoyl]-2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-ethoxy-3-pyridinyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2nc(OCC)ccc2-c2ccc(C(=O)NC(CCN)C(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C29H34N6O5/c1-4-40-24-12-11-21(25(35-24)28(37)33-19-8-5-17(6-9-19)26(31)32)20-10-7-18(15-22(20)29(38)39)27(36)34-23(13-14-30)16(2)3/h5-12,15-16,23H,4,13-14,30H2,1-3H3,(H3,31,32)(H,33,37)(H,34,36)(H,38,39) |
| InChIKey | YLMIUYPGWCMZAJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 193.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|