C32H30N4O6 — CID 22626252
2-[3-[(4-carbamimidoylphenyl)carbamoyl]naphthalen-2-yl]-5-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoyl]benzoic acid (PubChem CID 22626252) has the molecular formula C32H30N4O6 and a molecular weight of 566.61 g/mol. Its IUPAC name is 2-[3-[(4-carbamimidoylphenyl)carbamoyl]naphthalen-2-yl]-5-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoyl]benzoic acid.
| Compound Name | 2-[3-[(4-carbamimidoylphenyl)carbamoyl]naphthalen-2-yl]-5-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 22626252 |
| Molecular Formula | C32H30N4O6 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 2-[3-[(4-carbamimidoylphenyl)carbamoyl]naphthalen-2-yl]-5-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc3ccccc3cc2-c2ccc(C(=O)NC(C(=O)OC)C(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C32H30N4O6/c1-17(2)27(32(41)42-3)36-29(37)21-10-13-23(26(16-21)31(39)40)24-14-19-6-4-5-7-20(19)15-25(24)30(38)35-22-11-8-18(9-12-22)28(33)34/h4-17,27H,1-3H3,(H3,33,34)(H,35,38)(H,36,37)(H,39,40) |
| InChIKey | JPONCYJEVHVURH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 171.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|