C32H37N5O4 — CID 22626428
methyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-[(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)carbamoyl]benzoate (PubChem CID 22626428) has the molecular formula C32H37N5O4 and a molecular weight of 555.68 g/mol. Its IUPAC name is methyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-[(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)carbamoyl]benzoate.
| Compound Name | methyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-[(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 22626428 |
| Molecular Formula | C32H37N5O4 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | methyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-[(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)carbamoyl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccccc2-c2ccc(C(=O)NC(CN3CCCC3)C(C)C)cc2C(=O)OC)cc1 |
| InChI | InChI=1S/C32H37N5O4/c1-20(2)28(19-37-16-6-7-17-37)36-30(38)22-12-15-25(27(18-22)32(40)41-3)24-8-4-5-9-26(24)31(39)35-23-13-10-21(11-14-23)29(33)34/h4-5,8-15,18,20,28H,6-7,16-17,19H2,1-3H3,(H3,33,34)(H,35,39)(H,36,38) |
| InChIKey | PJLXXBXKCLMQKH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|