C26H26N4O4 — CID 22626158
5-(butylcarbamoyl)-2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoic acid (PubChem CID 22626158) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 5-(butylcarbamoyl)-2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoic acid.
| Compound Name | 5-(butylcarbamoyl)-2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 22626158 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 5-(butylcarbamoyl)-2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccccc2-c2ccc(C(=O)NCCCC)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H26N4O4/c1-2-3-14-29-24(31)17-10-13-20(22(15-17)26(33)34)19-6-4-5-7-21(19)25(32)30-18-11-8-16(9-12-18)23(27)28/h4-13,15H,2-3,14H2,1H3,(H3,27,28)(H,29,31)(H,30,32)(H,33,34) |
| InChIKey | DKXAXAMEBCWDPP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|