C27H26N4O7 — CID 18685498
methoxymethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-[(2-methoxy-2-oxoethyl)carbamoyl]phenyl]benzoate (PubChem CID 18685498) has the molecular formula C27H26N4O7 and a molecular weight of 518.53 g/mol. Its IUPAC name is methoxymethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-[(2-methoxy-2-oxoethyl)carbamoyl]phenyl]benzoate.
| Compound Name | methoxymethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-[(2-methoxy-2-oxoethyl)carbamoyl]phenyl]benzoate |
|---|---|
| PubChem CID | 18685498 |
| Molecular Formula | C27H26N4O7 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | methoxymethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-[(2-methoxy-2-oxoethyl)carbamoyl]phenyl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(C(=O)NCC(=O)OC)ccc2-c2ccccc2C(=O)OCOC)cc1 |
| InChI | InChI=1S/C27H26N4O7/c1-36-15-38-27(35)21-6-4-3-5-19(21)20-12-9-17(25(33)30-14-23(32)37-2)13-22(20)26(34)31-18-10-7-16(8-11-18)24(28)29/h3-13H,14-15H2,1-2H3,(H3,28,29)(H,30,33)(H,31,34) |
| InChIKey | DQNAYIQYBGPEOE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 169.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|