C28H25N3O5 — CID 22626024
methoxymethyl 2-[3-[(4-carbamimidoylphenyl)carbamoyl]-5-methoxynaphthalen-2-yl]benzoate (PubChem CID 22626024) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is methoxymethyl 2-[3-[(4-carbamimidoylphenyl)carbamoyl]-5-methoxynaphthalen-2-yl]benzoate.
| Compound Name | methoxymethyl 2-[3-[(4-carbamimidoylphenyl)carbamoyl]-5-methoxynaphthalen-2-yl]benzoate |
|---|---|
| PubChem CID | 22626024 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | methoxymethyl 2-[3-[(4-carbamimidoylphenyl)carbamoyl]-5-methoxynaphthalen-2-yl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc3c(OC)cccc3cc2-c2ccccc2C(=O)OCOC)cc1 |
| InChI | InChI=1S/C28H25N3O5/c1-34-16-36-28(33)21-8-4-3-7-20(21)23-14-18-6-5-9-25(35-2)22(18)15-24(23)27(32)31-19-12-10-17(11-13-19)26(29)30/h3-15H,16H2,1-2H3,(H3,29,30)(H,31,32) |
| InChIKey | HHFAHYUAGVIYOS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|