C36H29N3O5 — CID 22626208
dibenzyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzene-1,2-dicarboxylate (PubChem CID 22626208) has the molecular formula C36H29N3O5 and a molecular weight of 583.64 g/mol. Its IUPAC name is dibenzyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzene-1,2-dicarboxylate.
| Compound Name | dibenzyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 22626208 |
| Molecular Formula | C36H29N3O5 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | dibenzyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzene-1,2-dicarboxylate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccccc2-c2cccc(C(=O)OCc3ccccc3)c2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H29N3O5/c37-33(38)26-18-20-27(21-19-26)39-34(40)30-15-8-7-14-28(30)29-16-9-17-31(35(41)43-22-24-10-3-1-4-11-24)32(29)36(42)44-23-25-12-5-2-6-13-25/h1-21H,22-23H2,(H3,37,38)(H,39,40) |
| InChIKey | FFOXJGGSCIDBRK-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|