C24H23N3O3 — CID 59110673
benzyl 2-benzyl-3-(4-carbamimidoylanilino)-3-oxopropanoate (PubChem CID 59110673) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is benzyl 2-benzyl-3-(4-carbamimidoylanilino)-3-oxopropanoate.
| Compound Name | benzyl 2-benzyl-3-(4-carbamimidoylanilino)-3-oxopropanoate |
|---|---|
| PubChem CID | 59110673 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | benzyl 2-benzyl-3-(4-carbamimidoylanilino)-3-oxopropanoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C(Cc2ccccc2)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N3O3/c25-22(26)19-11-13-20(14-12-19)27-23(28)21(15-17-7-3-1-4-8-17)24(29)30-16-18-9-5-2-6-10-18/h1-14,21H,15-16H2,(H3,25,26)(H,27,28) |
| InChIKey | LFPBFDXOTPOKFS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|