C33H34N4O2 — CID 59110600
N-(4-carbamimidoylphenyl)-N'-[2-(4-methylphenyl)-1-phenylethyl]-2-(2-phenylethyl)propanediamide (PubChem CID 59110600) has the molecular formula C33H34N4O2 and a molecular weight of 518.66 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-[2-(4-methylphenyl)-1-phenylethyl]-2-(2-phenylethyl)propanediamide.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-[2-(4-methylphenyl)-1-phenylethyl]-2-(2-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 59110600 |
| Molecular Formula | C33H34N4O2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-[2-(4-methylphenyl)-1-phenylethyl]-2-(2-phenylethyl)propanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C(CCc2ccccc2)C(=O)NC(Cc2ccc(C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H34N4O2/c1-23-12-14-25(15-13-23)22-30(26-10-6-3-7-11-26)37-33(39)29(21-16-24-8-4-2-5-9-24)32(38)36-28-19-17-27(18-20-28)31(34)35/h2-15,17-20,29-30H,16,21-22H2,1H3,(H3,34,35)(H,36,38)(H,37,39) |
| InChIKey | SANHMEDWNJHTLH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|