C31H34N4O2 — CID 142132973
N-(4-carbamimidoylphenyl)-N'-[(1R)-1-(3-methyl-2,3-dihydronaphthalen-1-yl)ethyl]-2-(2-phenylethyl)propanediamide (PubChem CID 142132973) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-[(1R)-1-(3-methyl-2,3-dihydronaphthalen-1-yl)ethyl]-2-(2-phenylethyl)propanediamide.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-[(1R)-1-(3-methyl-2,3-dihydronaphthalen-1-yl)ethyl]-2-(2-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 142132973 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-[(1R)-1-(3-methyl-2,3-dihydronaphthalen-1-yl)ethyl]-2-(2-phenylethyl)propanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C(CCc2ccccc2)C(=O)N[C@H](C)C2=c3ccccc3=CC(C)C2)cc1 |
| InChI | InChI=1S/C31H34N4O2/c1-20-18-24-10-6-7-11-26(24)28(19-20)21(2)34-30(36)27(17-12-22-8-4-3-5-9-22)31(37)35-25-15-13-23(14-16-25)29(32)33/h3-11,13-16,18,20-21,27H,12,17,19H2,1-2H3,(H3,32,33)(H,34,36)(H,35,37)/t20?,21-,27?/m1/s1 |
| InChIKey | DZXKARPKHWDOAW-UYZKZEGUSA-N |
| XLogP | 3.33 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|