C30H34N4O2 — CID 73296797
N-[1-(4-carbamimidoylanilino)-1-oxo-3-phenylpropan-2-yl]-N-(cyclohexylmethyl)benzamide (PubChem CID 73296797) has the molecular formula C30H34N4O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-[1-(4-carbamimidoylanilino)-1-oxo-3-phenylpropan-2-yl]-N-(cyclohexylmethyl)benzamide.
| Compound Name | N-[1-(4-carbamimidoylanilino)-1-oxo-3-phenylpropan-2-yl]-N-(cyclohexylmethyl)benzamide |
|---|---|
| PubChem CID | 73296797 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | N-[1-(4-carbamimidoylanilino)-1-oxo-3-phenylpropan-2-yl]-N-(cyclohexylmethyl)benzamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C(Cc2ccccc2)N(CC2CCCCC2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H34N4O2/c31-28(32)24-16-18-26(19-17-24)33-29(35)27(20-22-10-4-1-5-11-22)34(21-23-12-6-2-7-13-23)30(36)25-14-8-3-9-15-25/h1,3-5,8-11,14-19,23,27H,2,6-7,12-13,20-21H2,(H3,31,32)(H,33,35) |
| InChIKey | TWSJFOIZFDSRQS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|