C28H23N3O3 — CID 22626543
benzyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoate (PubChem CID 22626543) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is benzyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoate.
| Compound Name | benzyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoate |
|---|---|
| PubChem CID | 22626543 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | benzyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccccc2-c2cccc(C(=O)OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H23N3O3/c29-26(30)20-13-15-23(16-14-20)31-27(32)25-12-5-4-11-24(25)21-9-6-10-22(17-21)28(33)34-18-19-7-2-1-3-8-19/h1-17H,18H2,(H3,29,30)(H,31,32) |
| InChIKey | MELPDZKYMWGKHI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|