C27H28N4O5 — CID 20631505
2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxyphenyl]-5-(2-methylpropylcarbamoyl)benzoic acid (PubChem CID 20631505) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxyphenyl]-5-(2-methylpropylcarbamoyl)benzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxyphenyl]-5-(2-methylpropylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 20631505 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-6-methoxyphenyl]-5-(2-methylpropylcarbamoyl)benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cccc(OC)c2-c2ccc(C(=O)NCC(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C27H28N4O5/c1-15(2)14-30-25(32)17-9-12-19(21(13-17)27(34)35)23-20(5-4-6-22(23)36-3)26(33)31-18-10-7-16(8-11-18)24(28)29/h4-13,15H,14H2,1-3H3,(H3,28,29)(H,30,32)(H,31,33)(H,34,35) |
| InChIKey | RAOQNJAYQSHGBW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 154.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|