C28H30N4O5 — CID 18685488
ethyl 2-[2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate (PubChem CID 18685488) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is ethyl 2-[2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate.
| Compound Name | ethyl 2-[2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 18685488 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | ethyl 2-[2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate |
| SMILES | CCOC(=O)c1cc(C(=O)NCC(C)C)ccc1-c1ccccc1C(=O)Nc1ccc(/C(N)=N/O)cc1 |
| InChI | InChI=1S/C28H30N4O5/c1-4-37-28(35)24-15-19(26(33)30-16-17(2)3)11-14-22(24)21-7-5-6-8-23(21)27(34)31-20-12-9-18(10-13-20)25(29)32-36/h5-15,17,36H,4,16H2,1-3H3,(H2,29,32)(H,30,33)(H,31,34) |
| InChIKey | DAYDKTHSQFATIP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|