C33H39N3O5S — CID 59879879
ethyl 2-[2-[[4-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]phenyl]sulfanylmethyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate (PubChem CID 59879879) has the molecular formula C33H39N3O5S and a molecular weight of 589.76 g/mol. Its IUPAC name is ethyl 2-[2-[[4-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]phenyl]sulfanylmethyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate.
| Compound Name | ethyl 2-[2-[[4-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]phenyl]sulfanylmethyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 59879879 |
| Molecular Formula | C33H39N3O5S |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | ethyl 2-[2-[[4-[N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]phenyl]sulfanylmethyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoate |
| SMILES | CCOC(=O)c1cc(C(=O)NCC(C)C)ccc1-c1ccccc1CSc1ccc(C(N)=NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C33H39N3O5S/c1-7-40-31(38)28-18-23(30(37)35-19-21(2)3)14-17-27(28)26-11-9-8-10-24(26)20-42-25-15-12-22(13-16-25)29(34)36-32(39)41-33(4,5)6/h8-18,21H,7,19-20H2,1-6H3,(H,35,37)(H2,34,36,39) |
| InChIKey | JGCKBFQQLUIYOZ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|