C24H29NO8 — CID 20631623
2-methoxyethoxymethyl 2-hydroxy-6-[2-methoxycarbonyl-4-(2-methylpropylcarbamoyl)phenyl]benzoate (PubChem CID 20631623) has the molecular formula C24H29NO8 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-methoxyethoxymethyl 2-hydroxy-6-[2-methoxycarbonyl-4-(2-methylpropylcarbamoyl)phenyl]benzoate.
| Compound Name | 2-methoxyethoxymethyl 2-hydroxy-6-[2-methoxycarbonyl-4-(2-methylpropylcarbamoyl)phenyl]benzoate |
|---|---|
| PubChem CID | 20631623 |
| Molecular Formula | C24H29NO8 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 2-methoxyethoxymethyl 2-hydroxy-6-[2-methoxycarbonyl-4-(2-methylpropylcarbamoyl)phenyl]benzoate |
| SMILES | COCCOCOC(=O)c1c(O)cccc1-c1ccc(C(=O)NCC(C)C)cc1C(=O)OC |
| InChI | InChI=1S/C24H29NO8/c1-15(2)13-25-22(27)16-8-9-17(19(12-16)23(28)31-4)18-6-5-7-20(26)21(18)24(29)33-14-32-11-10-30-3/h5-9,12,15,26H,10-11,13-14H2,1-4H3,(H,25,27) |
| InChIKey | QCAUYTNPLCNAMT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|