C27H27NO7 — CID 20826195
2-[2-methylperoxycarbonyl-4-(2-methylpropylcarbamoyl)phenyl]-5-phenylmethoxybenzoic acid (PubChem CID 20826195) has the molecular formula C27H27NO7 and a molecular weight of 477.51 g/mol. Its IUPAC name is 2-[2-methylperoxycarbonyl-4-(2-methylpropylcarbamoyl)phenyl]-5-phenylmethoxybenzoic acid.
| Compound Name | 2-[2-methylperoxycarbonyl-4-(2-methylpropylcarbamoyl)phenyl]-5-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 20826195 |
| Molecular Formula | C27H27NO7 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 2-[2-methylperoxycarbonyl-4-(2-methylpropylcarbamoyl)phenyl]-5-phenylmethoxybenzoic acid |
| SMILES | COOC(=O)c1cc(C(=O)NCC(C)C)ccc1-c1ccc(OCc2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C27H27NO7/c1-17(2)15-28-25(29)19-9-11-22(24(13-19)27(32)35-33-3)21-12-10-20(14-23(21)26(30)31)34-16-18-7-5-4-6-8-18/h4-14,17H,15-16H2,1-3H3,(H,28,29)(H,30,31) |
| InChIKey | NXOWPSVUSBZMKE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|