C24H22N4O5 — CID 18685497
ethyl (NZ)-N-[amino-[4-[[2-[2-(hydroxycarbamoyl)phenyl]benzoyl]amino]phenyl]methylidene]carbamate (PubChem CID 18685497) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is ethyl (NZ)-N-[amino-[4-[[2-[2-(hydroxycarbamoyl)phenyl]benzoyl]amino]phenyl]methylidene]carbamate.
| Compound Name | ethyl (NZ)-N-[amino-[4-[[2-[2-(hydroxycarbamoyl)phenyl]benzoyl]amino]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 18685497 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | ethyl (NZ)-N-[amino-[4-[[2-[2-(hydroxycarbamoyl)phenyl]benzoyl]amino]phenyl]methylidene]carbamate |
| SMILES | CCOC(=O)/N=C(\N)c1ccc(NC(=O)c2ccccc2-c2ccccc2C(=O)NO)cc1 |
| InChI | InChI=1S/C24H22N4O5/c1-2-33-24(31)27-21(25)15-11-13-16(14-12-15)26-22(29)19-9-5-3-7-17(19)18-8-4-6-10-20(18)23(30)28-32/h3-14,32H,2H2,1H3,(H,26,29)(H,28,30)(H2,25,27,31) |
| InChIKey | SQCHRNLIVSODRR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|