C36H34N4O6 — CID 10282579
2-[4-(4-ethenylphenyl)-2-[[4-[(E)-N'-methoxycarbonylcarbamimidoyl]phenyl]carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoic acid (PubChem CID 10282579) has the molecular formula C36H34N4O6 and a molecular weight of 618.69 g/mol. Its IUPAC name is 2-[4-(4-ethenylphenyl)-2-[[4-[(E)-N'-methoxycarbonylcarbamimidoyl]phenyl]carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoic acid.
| Compound Name | 2-[4-(4-ethenylphenyl)-2-[[4-[(E)-N'-methoxycarbonylcarbamimidoyl]phenyl]carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 10282579 |
| Molecular Formula | C36H34N4O6 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | 2-[4-(4-ethenylphenyl)-2-[[4-[(E)-N'-methoxycarbonylcarbamimidoyl]phenyl]carbamoyl]phenyl]-5-(2-methylpropylcarbamoyl)benzoic acid |
| SMILES | C=Cc1ccc(-c2ccc(-c3ccc(C(=O)NCC(C)C)cc3C(=O)O)c(C(=O)Nc3ccc(/C(N)=N\C(=O)OC)cc3)c2)cc1 |
| InChI | InChI=1S/C36H34N4O6/c1-5-22-6-8-23(9-7-22)25-12-16-28(29-17-13-26(19-31(29)35(43)44)33(41)38-20-21(2)3)30(18-25)34(42)39-27-14-10-24(11-15-27)32(37)40-36(45)46-4/h5-19,21H,1,20H2,2-4H3,(H,38,41)(H,39,42)(H,43,44)(H2,37,40,45) |
| InChIKey | NBLQLISVKOOHDT-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 160.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|