C28H32N4O2 — CID 11487905
4-[2-[(4-carbamimidoylanilino)methyl]-4-ethenyl-5-methoxyphenyl]-N-(2-methylpropyl)benzamide (PubChem CID 11487905) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 4-[2-[(4-carbamimidoylanilino)methyl]-4-ethenyl-5-methoxyphenyl]-N-(2-methylpropyl)benzamide.
| Compound Name | 4-[2-[(4-carbamimidoylanilino)methyl]-4-ethenyl-5-methoxyphenyl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 11487905 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 4-[2-[(4-carbamimidoylanilino)methyl]-4-ethenyl-5-methoxyphenyl]-N-(2-methylpropyl)benzamide |
| SMILES | [H]/N=C(\N)c1ccc(NCc2cc(C=C)c(OC)cc2-c2ccc(C(=O)NCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H32N4O2/c1-5-19-14-23(17-31-24-12-10-21(11-13-24)27(29)30)25(15-26(19)34-4)20-6-8-22(9-7-20)28(33)32-16-18(2)3/h5-15,18,31H,1,16-17H2,2-4H3,(H3,29,30)(H,32,33) |
| InChIKey | OUOIOHYRLVGZRD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|