C27H30N4O5 — CID 22626459
ethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2,2-dimethylpropylcarbamoyl)furan-3-carboxylate (PubChem CID 22626459) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is ethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2,2-dimethylpropylcarbamoyl)furan-3-carboxylate.
| Compound Name | ethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2,2-dimethylpropylcarbamoyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 22626459 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | ethyl 2-[2-[(4-carbamimidoylphenyl)carbamoyl]phenyl]-5-(2,2-dimethylpropylcarbamoyl)furan-3-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2ccccc2-c2oc(C(=O)NCC(C)(C)C)cc2C(=O)OCC)cc1 |
| InChI | InChI=1S/C27H30N4O5/c1-5-35-26(34)20-14-21(25(33)30-15-27(2,3)4)36-22(20)18-8-6-7-9-19(18)24(32)31-17-12-10-16(11-13-17)23(28)29/h6-14H,5,15H2,1-4H3,(H3,28,29)(H,30,33)(H,31,32) |
| InChIKey | SNPWYLJRNPZBHZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|