C19H33N3O2 — CID 142176662
ethane;N-[[(2E,4Z)-hexa-2,4-dien-3-yl]carbamoyl]benzamide;methanamine (PubChem CID 142176662) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is ethane;N-[[(2E,4Z)-hexa-2,4-dien-3-yl]carbamoyl]benzamide;methanamine.
| Compound Name | ethane;N-[[(2E,4Z)-hexa-2,4-dien-3-yl]carbamoyl]benzamide;methanamine |
|---|---|
| PubChem CID | 142176662 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | ethane;N-[[(2E,4Z)-hexa-2,4-dien-3-yl]carbamoyl]benzamide;methanamine |
| SMILES | C/C=C\C(=C/C)NC(=O)NC(=O)c1ccccc1.CC.CC.CN |
| InChI | InChI=1S/C14H16N2O2.2C2H6.CH5N/c1-3-8-12(4-2)15-14(18)16-13(17)11-9-6-5-7-10-11;3*1-2/h3-10H,1-2H3,(H2,15,16,17,18);2*1-2H3;2H2,1H3/b8-3-,12-4+;;; |
| InChIKey | JBFOBOVRDXXGAN-NTSLTJDFSA-N |
| XLogP | 4.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|