C21H15ClN2O3 — CID 22148102
(E)-2-benzamido-3-[6-(2-chlorophenyl)-2-pyridinyl]prop-2-enoic acid (PubChem CID 22148102) has the molecular formula C21H15ClN2O3 and a molecular weight of 378.82 g/mol. Its IUPAC name is (E)-2-benzamido-3-[6-(2-chlorophenyl)-2-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-2-benzamido-3-[6-(2-chlorophenyl)-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22148102 |
| Molecular Formula | C21H15ClN2O3 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (E)-2-benzamido-3-[6-(2-chlorophenyl)-2-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1cccc(-c2ccccc2Cl)n1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H15ClN2O3/c22-17-11-5-4-10-16(17)18-12-6-9-15(23-18)13-19(21(26)27)24-20(25)14-7-2-1-3-8-14/h1-13H,(H,24,25)(H,26,27)/b19-13+ |
| InChIKey | BCAQVLVQQUXMFV-CPNJWEJPSA-N |
| XLogP | 4.26 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|