C21H16ClNO4S — CID 91212836
2-benzamido-3-[5-[(2-chlorophenyl)methylsulfanyl]furan-2-yl]prop-2-enoic acid (PubChem CID 91212836) has the molecular formula C21H16ClNO4S and a molecular weight of 413.88 g/mol. Its IUPAC name is 2-benzamido-3-[5-[(2-chlorophenyl)methylsulfanyl]furan-2-yl]prop-2-enoic acid.
| Compound Name | 2-benzamido-3-[5-[(2-chlorophenyl)methylsulfanyl]furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91212836 |
| Molecular Formula | C21H16ClNO4S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 2-benzamido-3-[5-[(2-chlorophenyl)methylsulfanyl]furan-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)C(=Cc1ccc(SCc2ccccc2Cl)o1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H16ClNO4S/c22-17-9-5-4-8-15(17)13-28-19-11-10-16(27-19)12-18(21(25)26)23-20(24)14-6-2-1-3-7-14/h1-12H,13H2,(H,23,24)(H,25,26) |
| InChIKey | YWLYGROPLCHPJB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|