C28H20ClN3O4S — CID 19057054
N-[(Z)-1-[5-(1,3-benzoxazol-2-ylsulfanyl)furan-2-yl]-3-[(2-chlorophenyl)methylamino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19057054) has the molecular formula C28H20ClN3O4S and a molecular weight of 530.01 g/mol. Its IUPAC name is N-[(Z)-1-[5-(1,3-benzoxazol-2-ylsulfanyl)furan-2-yl]-3-[(2-chlorophenyl)methylamino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-[5-(1,3-benzoxazol-2-ylsulfanyl)furan-2-yl]-3-[(2-chlorophenyl)methylamino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19057054 |
| Molecular Formula | C28H20ClN3O4S |
| Molecular Weight | 530.01 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | N-[(Z)-1-[5-(1,3-benzoxazol-2-ylsulfanyl)furan-2-yl]-3-[(2-chlorophenyl)methylamino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NCc1ccccc1Cl)/C(=C/c1ccc(Sc2nc3ccccc3o2)o1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H20ClN3O4S/c29-21-11-5-4-10-19(21)17-30-27(34)23(31-26(33)18-8-2-1-3-9-18)16-20-14-15-25(35-20)37-28-32-22-12-6-7-13-24(22)36-28/h1-16H,17H2,(H,30,34)(H,31,33)/b23-16- |
| InChIKey | WQQPHAYLTSRBPX-KQWNVCNZSA-N |
| XLogP | 6.31 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.01 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|