C21H16N2O3S — CID 76843390
N-[1-[5-(2-aminophenyl)thiophen-2-yl]-3,4-dioxobut-1-en-2-yl]benzamide (PubChem CID 76843390) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[1-[5-(2-aminophenyl)thiophen-2-yl]-3,4-dioxobut-1-en-2-yl]benzamide.
| Compound Name | N-[1-[5-(2-aminophenyl)thiophen-2-yl]-3,4-dioxobut-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 76843390 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[1-[5-(2-aminophenyl)thiophen-2-yl]-3,4-dioxobut-1-en-2-yl]benzamide |
| SMILES | Nc1ccccc1-c1ccc(C=C(NC(=O)c2ccccc2)C(=O)C=O)s1 |
| InChI | InChI=1S/C21H16N2O3S/c22-17-9-5-4-8-16(17)20-11-10-15(27-20)12-18(19(25)13-24)23-21(26)14-6-2-1-3-7-14/h1-13H,22H2,(H,23,26) |
| InChIKey | YQNOCLMEPFIVGZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|