C21H15Cl2FNO2P — CID 4603771
N-(2,2-dichloro-1-diphenylphosphorylethenyl)-4-fluorobenzamide (PubChem CID 4603771) has the molecular formula C21H15Cl2FNO2P and a molecular weight of 434.23 g/mol. Its IUPAC name is N-(2,2-dichloro-1-diphenylphosphorylethenyl)-4-fluorobenzamide.
| Compound Name | N-(2,2-dichloro-1-diphenylphosphorylethenyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 4603771 |
| Molecular Formula | C21H15Cl2FNO2P |
| Molecular Weight | 434.23 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | N-(2,2-dichloro-1-diphenylphosphorylethenyl)-4-fluorobenzamide |
| SMILES | O=C(NC(=C(Cl)Cl)P(=O)(c1ccccc1)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H15Cl2FNO2P/c22-19(23)21(25-20(26)15-11-13-16(24)14-12-15)28(27,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14H,(H,25,26) |
| InChIKey | AAAWDESCCWQWSZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.23 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|