C16H15FN2O3 — CID 171561206
(2S)-2-[2-(4-fluorobenzoyl)hydrazinyl]-3-phenylpropanoic acid (PubChem CID 171561206) has the molecular formula C16H15FN2O3 and a molecular weight of 302.31 g/mol. Its IUPAC name is (2S)-2-[2-(4-fluorobenzoyl)hydrazinyl]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[2-(4-fluorobenzoyl)hydrazinyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 171561206 |
| Molecular Formula | C16H15FN2O3 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (2S)-2-[2-(4-fluorobenzoyl)hydrazinyl]-3-phenylpropanoic acid |
| SMILES | O=C(NN[C@@H](Cc1ccccc1)C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN2O3/c17-13-8-6-12(7-9-13)15(20)19-18-14(16(21)22)10-11-4-2-1-3-5-11/h1-9,14,18H,10H2,(H,19,20)(H,21,22)/t14-/m0/s1 |
| InChIKey | BXALZSHPJQDVCK-AWEZNQCLSA-N |
| XLogP | 1.76 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|