C24H27OP — CID 2776719
1-(diphenylphosphorylmethyl)-2,3,4,5,6-pentamethylbenzene (PubChem CID 2776719) has the molecular formula C24H27OP and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-(diphenylphosphorylmethyl)-2,3,4,5,6-pentamethylbenzene.
| Compound Name | 1-(diphenylphosphorylmethyl)-2,3,4,5,6-pentamethylbenzene |
|---|---|
| PubChem CID | 2776719 |
| Molecular Formula | C24H27OP |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-(diphenylphosphorylmethyl)-2,3,4,5,6-pentamethylbenzene |
| SMILES | Cc1c(C)c(C)c(CP(=O)(c2ccccc2)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C24H27OP/c1-17-18(2)20(4)24(21(5)19(17)3)16-26(25,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15H,16H2,1-5H3 |
| InChIKey | LVJBDMNJQPSKMA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|