C30H27NO2P2 — CID 102311609
2,5-bis(diphenylphosphorylmethyl)-1H-pyrrole (PubChem CID 102311609) has the molecular formula C30H27NO2P2 and a molecular weight of 495.50 g/mol. Its IUPAC name is 2,5-bis(diphenylphosphorylmethyl)-1H-pyrrole.
| Compound Name | 2,5-bis(diphenylphosphorylmethyl)-1H-pyrrole |
|---|---|
| PubChem CID | 102311609 |
| Molecular Formula | C30H27NO2P2 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 2,5-bis(diphenylphosphorylmethyl)-1H-pyrrole |
| SMILES | O=P(Cc1ccc(CP(=O)(c2ccccc2)c2ccccc2)[nH]1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H27NO2P2/c32-34(27-13-5-1-6-14-27,28-15-7-2-8-16-28)23-25-21-22-26(31-25)24-35(33,29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-22,31H,23-24H2 |
| InChIKey | HBAGCBXYXPTFNW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|