C22H24O2P2 — CID 59816903
1,3-bis[ethyl(phenyl)phosphoryl]benzene (PubChem CID 59816903) has the molecular formula C22H24O2P2 and a molecular weight of 382.38 g/mol. Its IUPAC name is 1,3-bis[ethyl(phenyl)phosphoryl]benzene.
| Compound Name | 1,3-bis[ethyl(phenyl)phosphoryl]benzene |
|---|---|
| PubChem CID | 59816903 |
| Molecular Formula | C22H24O2P2 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1,3-bis[ethyl(phenyl)phosphoryl]benzene |
| SMILES | CCP(=O)(c1ccccc1)c1cccc(P(=O)(CC)c2ccccc2)c1 |
| InChI | InChI=1S/C22H24O2P2/c1-3-25(23,19-12-7-5-8-13-19)21-16-11-17-22(18-21)26(24,4-2)20-14-9-6-10-15-20/h5-18H,3-4H2,1-2H3 |
| InChIKey | BFDXVUPERSQQFT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|