About [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+)
[diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+) (PubChem CID 170659309) has the molecular formula C25H22O2P2Tb+3
and a molecular weight of 575.32 g/mol. Its IUPAC name is [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+).
Molecular Properties
| Compound Name | [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+) |
| PubChem CID | 170659309 |
| Molecular Formula | C25H22O2P2Tb+3 |
| Molecular Weight | 575.32 g/mol |
| Exact Mass | 575.03 |
| IUPAC Name | [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+) |
| SMILES | O=P(CP(=O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.[Tb+3] |
| InChI | InChI=1S/C25H22O2P2.Tb/c26-28(22-13-5-1-6-14-22,23-15-7-2-8-16-23)21-29(27,24-17-9-3-10-18-24)25-19-11-4-12-20-25;/h1-20H,21H2;/q;+3 |
| InChIKey | DSXDGSFKXIEHBX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 575.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+)?
The IUPAC name of [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+) (CID 170659309) is [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+).
What is the SMILES notation for [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+)?
The canonical SMILES for [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+) is O=P(CP(=O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.[Tb+3].
What is the InChIKey of [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+)?
The InChIKey is DSXDGSFKXIEHBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22O2P2.Tb/c26-28(22-13-5-1-6-14-22,23-15-7-2-8-16-23)21-29(27,24-17-9-3-10-18-24)25-19-11-4-12-20-25;/h1-20H,21H2;/q;+3.
What are the key properties of [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+)?
[diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+) has a molecular weight of 575.32 g/mol, XLogP of 4.97, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [diphenylphosphorylmethyl(phenyl)phosphoryl]benzene;terbium(3+) is sourced from PubChem (CID 170659309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).